Introduction：Basic information about CAS 423181-29-7|Benzyl (4-chloro-3-cyano-7-quinolinyl)methylcarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl (4-chloro-3-cyano-7-quinolinyl)methylcarbamate |
|---|
| CAS Number | 423181-29-7 | Molecular Weight | 351.78600 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 538.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H14ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.4ºC |
|---|
Names
| Name | Benzyl (4-chloro-3-cyano-7-quinolinyl)methylcarbamate |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 538.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H14ClN3O2 |
|---|
| Molecular Weight | 351.78600 |
|---|
| Flash Point | 279.4ºC |
|---|
| Exact Mass | 351.07700 |
|---|
| PSA | 66.22000 |
|---|
| LogP | 4.53288 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | WHTQAWORTCWWQB-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnc2cc(CNC(=O)OCc3ccccc3)ccc2c1Cl |
|---|
