Introduction:Basic information about CAS 423181-33-3|N-(4-Chloro-3-cyano-7-methoxy-6-quinolinyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Chloro-3-cyano-7-methoxy-6-quinolinyl)acetamide |
|---|
| CAS Number | 423181-33-3 | Molecular Weight | 275.69000 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 514ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.7ºC |
|---|
Names
| Name | N-(4-Chloro-3-cyano-7-methoxy-6-quinolinyl)acetamide |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 514ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClN3O2 |
|---|
| Molecular Weight | 275.69000 |
|---|
| Flash Point | 264.7ºC |
|---|
| Exact Mass | 275.04600 |
|---|
| PSA | 78.50000 |
|---|
| LogP | 3.37638 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | TYJFVYISYHLVCW-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2ncc(C#N)c(Cl)c2cc1NC(C)=O |
|---|