Introduction：Basic information about CAS 541505-09-3|4-Chloro-5-[(1-methyl-4-piperidinyl)oxy]-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-5-[(1-methyl-4-piperidinyl)oxy]-3-quinolinecarbonitrile |
|---|
| CAS Number | 541505-09-3 | Molecular Weight | 301.77100 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 464.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.5ºC |
|---|
Names
| Name | 4-Chloro-5-[(1-methyl-4-piperidinyl)oxy]-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 464.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16ClN3O |
|---|
| Molecular Weight | 301.77100 |
|---|
| Flash Point | 234.5ºC |
|---|
| Exact Mass | 301.09800 |
|---|
| PSA | 49.15000 |
|---|
| LogP | 3.17078 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | SJBVKUZOGQKEAG-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCC(Oc2cccc3ncc(C#N)c(Cl)c23)CC1 |
|---|
