Introduction：Basic information about CAS 857762-44-8|4-Chloro-6-methoxy-8-nitro-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-methoxy-8-nitro-3-quinolinecarbonitrile |
|---|
| CAS Number | 857762-44-8 | Molecular Weight | 263.63700 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 471.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.7ºC |
|---|
Names
| Name | 4-Chloro-6-methoxy-8-nitro-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 471.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6ClN3O3 |
|---|
| Molecular Weight | 263.63700 |
|---|
| Flash Point | 238.7ºC |
|---|
| Exact Mass | 263.01000 |
|---|
| PSA | 91.73000 |
|---|
| LogP | 3.19988 |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | NRILXMXZHYICSI-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c2ncc(C#N)c(Cl)c2c1 |
|---|
