Introduction：Basic information about CAS 915369-18-5|4-Chloro-3-cyano-N,N-dimethyl-6-nitro-8-quinolinecarboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-3-cyano-N,N-dimethyl-6-nitro-8-quinolinecarboxamide |
|---|
| CAS Number | 915369-18-5 | Molecular Weight | 304.68900 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 548.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9ClN4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285.5ºC |
|---|
Names
| Name | 4-Chloro-3-cyano-N,N-dimethyl-6-nitro-8-quinolinecarboxamide |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 548.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9ClN4O3 |
|---|
| Molecular Weight | 304.68900 |
|---|
| Flash Point | 285.5ºC |
|---|
| Exact Mass | 304.03600 |
|---|
| PSA | 102.81000 |
|---|
| LogP | 2.89308 |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | FMNPIDJYMQZIIN-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C(=O)c1cc([N+](=O)[O-])cc2c(Cl)c(C#N)cnc12 |
|---|
