Introduction：Basic information about CAS 915369-70-9|4-Chloro-6-nitro-8-(trifluoromethyl)-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-nitro-8-(trifluoromethyl)-3-quinolinecarbonitrile |
|---|
| CAS Number | 915369-70-9 | Molecular Weight | 301.60900 |
|---|
| Density | 1.66g/cm3 | Boiling Point | 416.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H3ClF3N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.9ºC |
|---|
Names
| Name | 4-Chloro-6-nitro-8-(trifluoromethyl)-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.66g/cm3 |
|---|
| Boiling Point | 416.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H3ClF3N3O2 |
|---|
| Molecular Weight | 301.60900 |
|---|
| Flash Point | 205.9ºC |
|---|
| Exact Mass | 300.98700 |
|---|
| PSA | 82.50000 |
|---|
| LogP | 4.21008 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | CEWAJPJXYXIFPP-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnc2c(C(F)(F)F)cc([N+](=O)[O-])cc2c1Cl |
|---|
