Introduction：Basic information about CAS 267425-74-1|7-Benzyl-8-hydroxy-1-oxa-7-azaspiro[4.4]nonan-6-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Benzyl-8-hydroxy-1-oxa-7-azaspiro[4.4]nonan-6-one |
|---|
| CAS Number | 267425-74-1 | Molecular Weight | 247.29000 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 493.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.1ºC |
|---|
Names
| Name | 7-Benzyl-8-hydroxy-1-oxa-7-azaspiro[4.4]nonan-6-one |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 493.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO3 |
|---|
| Molecular Weight | 247.29000 |
|---|
| Flash Point | 252.1ºC |
|---|
| Exact Mass | 247.12100 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 1.22440 |
|---|
| Vapour Pressure | 1.51E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | UULUZKUVIPEOGF-UHFFFAOYSA-N |
|---|
| SMILES | O=C1N(Cc2ccccc2)C(O)CC12CCCO2 |
|---|
