Introduction：Basic information about CAS 118736-04-2|tert-Butyl[4-(dimethoxymethyl)phenoxy]dimethylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl[4-(dimethoxymethyl)phenoxy]dimethylsilane |
|---|
| CAS Number | 118736-04-2 | Molecular Weight | 282.451 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 287.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H26O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 106.7±25.0 °C |
|---|
Names
| Name | tert-Butyl[4-(dimethoxymethyl)phenoxy]dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 287.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H26O3Si |
|---|
| Molecular Weight | 282.451 |
|---|
| Flash Point | 106.7±25.0 °C |
|---|
| Exact Mass | 282.165131 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 0.63 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | DGWQQAQYHUNLGD-UHFFFAOYSA-N |
|---|
| SMILES | COC(OC)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
|---|
Synonyms
| tert-butyl-[4-(dimethoxymethyl)phenoxy]-dimethylsilane |
| 4-(tert-Butyldimethylsilyloxy)benzaldehyde Dimethyl Acetal |
| Benzene, 1-(dimethoxymethyl)-4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]- |
| 1-(tert-Butyldimethylsilyloxy)-4-(dimethoxymethyl)benzene |
| [4-(Dimethoxymethyl)phenoxy](dimethyl)(2-methyl-2-propanyl)silane |
| tert-Butyl[4-(diMethoxyMethyl)phenoxy]diMethylsilane |
