Introduction：Basic information about CAS 1214360-56-1|[3-Nitro-4-(trifluoromethyl)phenyl]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [3-Nitro-4-(trifluoromethyl)phenyl]acetic acid |
|---|
| CAS Number | 1214360-56-1 | Molecular Weight | 249.143 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 369.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.5±27.9 °C |
|---|
Names
| Name | 2-[3-nitro-4-(trifluoromethyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 369.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F3NO4 |
|---|
| Molecular Weight | 249.143 |
|---|
| Flash Point | 177.5±27.9 °C |
|---|
| Exact Mass | 249.024887 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 1.87 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | JNYXIDXDESMHBW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
|---|
Synonyms
| [3-Nitro-4-(trifluoromethyl)phenyl]acetic acid |
| 2-(3-Nitro-4-(trifluoromethyl)phenyl)acetic acid |
| Benzeneacetic acid, 3-nitro-4-(trifluoromethyl)- |
