Introduction：Basic information about CAS 1210-96-4|1,5-Dimethoxy-2,4-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,5-Dimethoxy-2,4-dinitrobenzene |
|---|
| CAS Number | 1210-96-4 | Molecular Weight | 228.15900 |
|---|
| Density | 1.416 g/cm3 | Boiling Point | 410.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.7ºC |
|---|
Names
| Name | 1,5-Dimethoxy-2,4-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.416 g/cm3 |
|---|
| Boiling Point | 410.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O6 |
|---|
| Molecular Weight | 228.15900 |
|---|
| Flash Point | 205.7ºC |
|---|
| Exact Mass | 228.03800 |
|---|
| PSA | 110.10000 |
|---|
| LogP | 2.56660 |
|---|
| InChIKey | FNFRSLVCFFJHEE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4.6-Dinitro-resorcin-dimethylaether |
| 2,4-dimethoxy-1,5-dinitrobenzene |
| 4,6-dimethoxy-1,3-dinitrobenzene |
| 1,3-dinitro-4,6-dimethoxybenzene |
| 1,3-dimethoxy-4,6-dinitrobenzene |
| 1,5-dimethoxy-2,4-dinitro-benzene |
| 1,5-Dimethoxy-2,4-dinitro-benzol |
