Introduction：Basic information about CAS 403-12-3|2-Fluoro-1-(3-nitrophenyl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-1-(3-nitrophenyl)ethanone |
|---|
| CAS Number | 403-12-3 | Molecular Weight | 183.137 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 258.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.4±20.4 °C |
|---|
Names
| Name | 2-Fluoro-1-(3-nitrophenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 258.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6FNO3 |
|---|
| Molecular Weight | 183.137 |
|---|
| Flash Point | 110.4±20.4 °C |
|---|
| Exact Mass | 183.033173 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 1.20 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | RCWJMAXPPJAFCJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CF)c1cccc([N+](=O)[O-])c1 |
|---|
Synonyms
| Ethanone, 2-fluoro-1-(3-nitrophenyl)- |
| 2-Fluor-1-(3-nitro-phenyl)-aethanon |
| 2-FLUORO-1-(3-NITROPHENYL)-ETHANONE |
| 2-Fluoro-1-(3-nitrophenyl)ethanone |
| 2-fluoro-3'-nitroacetophenone |
