Introduction：Basic information about CAS 128403-22-5|1-[2-Nitro-4-(trifluoromethyl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[2-Nitro-4-(trifluoromethyl)phenyl]ethanone |
|---|
| CAS Number | 128403-22-5 | Molecular Weight | 233.144 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 290.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.7±27.3 °C |
|---|
Names
| Name | 1-[2-Nitro-4-(trifluoromethyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 290.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F3NO3 |
|---|
| Molecular Weight | 233.144 |
|---|
| Flash Point | 129.7±27.3 °C |
|---|
| Exact Mass | 233.029984 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.487 |
|---|
| InChIKey | SUBBPOYWNZPKFM-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
|---|
Safety Information
Synonyms
| 1-[2-nitro-4-(trifluoromethyl)phenyl]ethan-1-one |
| 1-(2-Nitro-4-(trifluoromethyl)phenyl)ethanone |
| HMS563C13 |
| Ethanone, 1-[2-nitro-4-(trifluoromethyl)phenyl]- |
| 2-nitro-4-trifluoromethyl-acetophenone |
| 1-[2-Nitro-4-(trifluoromethyl)phenyl]ethanone |
| 1-(2-nitro-4-trifluoromethylphenyl)ethenone |
