Introduction：Basic information about CAS 704914-80-7|4-[Bis(4-methoxyphenyl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[Bis(4-methoxyphenyl)amino]benzoic acid |
|---|
| CAS Number | 704914-80-7 | Molecular Weight | 349.380 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 550.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.4±28.7 °C |
|---|
Names
| Name | 4-[Bis(4-methoxyphenyl)amino]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 550.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H19NO4 |
|---|
| Molecular Weight | 349.380 |
|---|
| Flash Point | 286.4±28.7 °C |
|---|
| Exact Mass | 349.131409 |
|---|
| PSA | 59.00000 |
|---|
| LogP | 3.91 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | IRIBVMYXYZOSQE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(C(=O)O)cc2)cc1 |
|---|
Synonyms
| 4-[Bis(4-methoxyphenyl)amino]benzoic acid |
| 4-[bis(4-fluorophenyl)methylene]-piperidine monohydrobromide |
| Benzoic acid, 4-[bis(4-methoxyphenyl)amino]- |
| 4-(N,N-bis(4-methoxyphenyl)amino)benzoic acid |
| 4-<bis(4-fluorophenyl)methylene>piperidine hydrobromide |
