Introduction：Basic information about CAS 801235-15-4|1-(2-Amino-3-chloro-5-methoxyphenyl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-Amino-3-chloro-5-methoxyphenyl)ethanone |
|---|
| CAS Number | 801235-15-4 | Molecular Weight | 199.634 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 319.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.2±27.9 °C |
|---|
Names
| Name | 1-(2-Amino-3-chloro-5-methoxyphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 319.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO2 |
|---|
| Molecular Weight | 199.634 |
|---|
| Flash Point | 147.2±27.9 °C |
|---|
| Exact Mass | 199.040009 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 3.14 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | DVGDMKXGEIYCLJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(Cl)c(N)c(C(C)=O)c1 |
|---|
Synonyms
| Ethanone,1-(2-amino-3-chloro-5-methoxyphenyl) |
| 1-(2-amino-3-chloro-5-methoxyphenyl)-Ethanone |
| 1-(2-Amino-3-chloro-5-methoxyphenyl)ethanone |
| Ethanone, 1-(2-amino-3-chloro-5-methoxyphenyl)- |
| A9945 |
| 2-acetyl-6-chloro-p-anisidine |
