Introduction:Basic information about CAS 950229-11-5|Phenyl 4-phenyl-1-piperazinecarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenyl 4-phenyl-1-piperazinecarboxylate |
|---|
| CAS Number | 950229-11-5 | Molecular Weight | 282.33700 |
|---|
| Density | 1.196g/cm3 | Boiling Point | 434.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.3ºC |
|---|
Names
| Name | Phenyl 4-phenyl-1-piperazinecarboxylate |
|---|
Chemical & Physical Properties
| Density | 1.196g/cm3 |
|---|
| Boiling Point | 434.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18N2O2 |
|---|
| Molecular Weight | 282.33700 |
|---|
| Flash Point | 216.3ºC |
|---|
| Exact Mass | 282.13700 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 3.01050 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XKQIITHNXREOGI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1ccccc1)N1CCN(c2ccccc2)CC1 |
|---|