Introduction：Basic information about CAS 21674-38-4|2,4,6-Tris(pentadecafluoroheptyl)-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6-Tris(pentadecafluoroheptyl)-1,3,5-triazine |
|---|
| CAS Number | 21674-38-4 | Molecular Weight | 1185.205 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 403.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24F45N3 | Melting Point | 26-29 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 197.8±31.5 °C |
|---|
Names
| Name | 2,4,6-tris(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3,5-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 403.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 26-29 °C(lit.) |
|---|
| Molecular Formula | C24F45N3 |
|---|
| Molecular Weight | 1185.205 |
|---|
| Flash Point | 197.8±31.5 °C |
|---|
| Exact Mass | 1184.937378 |
|---|
| PSA | 38.67000 |
|---|
| LogP | 24.23 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.300 |
|---|
| InChIKey | BFAUAMWYFFXWLX-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2,4,6-Tris(perfluoroheptyl)-1,3,5-triazine |
| tris(perfluoro-n-heptyl)-s-triazine |
| 2,3-DIMETHYL-2,3-BUTANEDIAMINE DIHYDROCHLORIDE |
| 1,3,5-Triazine, 2,4,6-tris(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)- |
| 1,3,5-Triazine, 2,4,6-tris(pentadecafluoroheptyl)- |
| tris<perfluoroheptyl>-s-triazine |
| Tris-perfluor-n-heptyl-s-triazin |
| MFCD00042439 |
| 2,4,6-Tris(pentadecafluoroheptyl)-1,3,5-triazine |
| 2,4,6-Tris-perfluorheptyl-triazin |
| EINECS 244-521-3 |
