Introduction：Basic information about CAS 59137-36-9|4'-[(S)-2-Methylbutyl]biphenyl-4-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-[(S)-2-Methylbutyl]biphenyl-4-carbonitrile |
|---|
| CAS Number | 59137-36-9 | Molecular Weight | 249.35000 |
|---|
| Density | 1.02g/cm3 | Boiling Point | 388.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.1ºC |
|---|
Names
| Name | 4'-[(2S)-2-Methylbutyl]-4-biphenylcarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.02g/cm3 |
|---|
| Boiling Point | 388.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19N |
|---|
| Molecular Weight | 249.35000 |
|---|
| Flash Point | 190.1ºC |
|---|
| Exact Mass | 249.15200 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 4.81388 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | DNJQGRFZQMOYGM-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)Cc1ccc(-c2ccc(C#N)cc2)cc1 |
|---|
| Storage condition | 2-8℃ |
|---|
