Introduction：Basic information about CAS 878207-91-1|2-(Methoxycarbonyl)-3-Methylpyridine 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Methoxycarbonyl)-3-Methylpyridine 1-oxide |
|---|
| CAS Number | 878207-91-1 | Molecular Weight | 167.16200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 3-methyl-2-pyridinecarboxylate 1-oxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H9NO3 |
|---|
| Molecular Weight | 167.16200 |
|---|
| Exact Mass | 167.05800 |
|---|
| PSA | 51.76000 |
|---|
| LogP | 1.21010 |
|---|
| InChIKey | YSRBMUMDFAGAAD-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1c(C)ccc[n+]1[O-] |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Methyl 3-hydroxy-5-methyl-2-thiophenecarboxylate |
| 2-methoxycarbonyl-3-hydroxy-5-methyl-thiophene |
| 3-Hydroxy-5-methyl-2-thiophenecarboxylic acid methyl ester |
| 3-methyl-2-pyridinecarboxylic acid 1-oxide methyl ester |
| 3-Hydroxy-5-methyl-thiophen-2-carbonsaeure-methylester |
| 2-Thiophenecarboxylic acid,3-hydroxy-5-methyl-,methyl ester |
| 3-hydroxy-5-methylthiophene-2-carboxylic acid methyl ester |
