Introduction：Basic information about CAS 1215206-34-0|6-(Trifluoromethoxy)quinoline hydrochloride (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(Trifluoromethoxy)quinoline hydrochloride (1:1) |
|---|
| CAS Number | 1215206-34-0 | Molecular Weight | 249.617 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H7ClF3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(trifluoromethoxy)quinoline,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H7ClF3NO |
|---|
| Molecular Weight | 249.617 |
|---|
| Exact Mass | 249.016830 |
|---|
| PSA | 22.12000 |
|---|
| LogP | 3.93540 |
|---|
| InChIKey | YXYBRJPHNSMIAC-UHFFFAOYSA-N |
|---|
| SMILES | Cl.FC(F)(F)Oc1ccc2ncccc2c1 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-(Trifluoromethoxy)quinoline hydrochloride |
| A-5478 |
| 6-(Trifluoromethoxy)quinoline HCl |
| 6-(Trifluoromethoxy)quinoline hydrochloride (1:1) |
| Quinoline, 6-(trifluoromethoxy)-, hydrochloride (1:1) |
| I08-991 |
