Introduction：Basic information about CAS 112665-41-5|ethyl 7-oxo-7-phenylheptanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 7-oxo-7-phenylheptanoate |
|---|
| CAS Number | 112665-41-5 | Molecular Weight | 248.31700 |
|---|
| Density | 1.035g/cm3 | Boiling Point | 353.736ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.394ºC |
|---|
Names
| Name | ethyl 7-oxo-7-phenylheptanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.035g/cm3 |
|---|
| Boiling Point | 353.736ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O3 |
|---|
| Molecular Weight | 248.31700 |
|---|
| Flash Point | 153.394ºC |
|---|
| Exact Mass | 248.14100 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.38290 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | DMINFMRYRQRRTD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CCCCCC(=O)c1ccccc1 |
|---|
Synonyms
| ethyl 7-oxo-7-phenyl-heptanoate |
| 7-oxo-7-phenyl-heptanoic acid ethyl ester |
| 7-Oxo-7-phenyl-heptansaeure-aethylester |
| ethyl 6-benzoyl-hexanoate |
