Introduction：Basic information about CAS 14295-72-8|3-(4-chlorophenyl)-4,5-dihydro-1-[4-(methylsulphonyl)phenyl]-1H-pyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-chlorophenyl)-4,5-dihydro-1-[4-(methylsulphonyl)phenyl]-1H-pyrazole |
|---|
| CAS Number | 14295-72-8 | Molecular Weight | 334.82100 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 527.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H15ClN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.6ºC |
|---|
Names
| Name | 5-(4-chlorophenyl)-2-(4-methylsulfonylphenyl)-3,4-dihydropyrazole |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 527.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H15ClN2O2S |
|---|
| Molecular Weight | 334.82100 |
|---|
| Flash Point | 272.6ºC |
|---|
| Exact Mass | 334.05400 |
|---|
| PSA | 58.12000 |
|---|
| LogP | 3.93930 |
|---|
| Vapour Pressure | 3.34E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | PEQYZILRIJSUBO-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1 |
|---|
