Introduction：Basic information about CAS 15540-85-9|3,6-Dimethyl-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-Dimethyl-2-nitroaniline |
|---|
| CAS Number | 15540-85-9 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 305.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138.2±26.5 °C |
|---|
Names
| Name | 3,6-dimethyl-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 305.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 138.2±26.5 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.75 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | DOEMKIFSRKILHU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c([N+](=O)[O-])c1N |
|---|
Safety Information
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,5-dimethyl-6-nitroaniline |
| 3,6-Dimethyl-2-nitroaniline |
| Benzenamine, 3,6-dimethyl-2-nitro- |
| 3,6-Dimethyl-2-nitro-anilin |
| 2,5-Dimethyl-6-nitroanilin |
| 3,6-dimethyl-2-nitro-aniline |
| Benzenamine,3,6-dimethyl-2-nitro |
| p-Nitro-p-xylidin |
| 3,6-dimethyl-2-nitrophenylamine |
| 6-Nitro-2,5-acetoxylidid |
| 2-amino-3-nitro-p-xylene |
