Introduction：Basic information about CAS 70009-66-4|Oxalinast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxalinast |
|---|
| CAS Number | 70009-66-4 | Molecular Weight | 259.25700 |
|---|
| Density | 1.486g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-oxo-2-[(2-oxo-6,7,8,8a-tetrahydro-1H-acenaphthylen-3-yl)amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.486g/cm3 |
|---|
| Molecular Formula | C14H13NO4 |
|---|
| Molecular Weight | 259.25700 |
|---|
| Exact Mass | 259.08400 |
|---|
| PSA | 83.47000 |
|---|
| LogP | 1.78900 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | DHMOBVVEHRKNIO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(=O)Nc1ccc2c3c1C(=O)CC3CCC2 |
|---|
Synonyms
| ( inverted exclamation markA)-(6,7,8,8a-tetrahydro-2-oxo-3-acenaphthenyl)oxamic acid |
| Oxalinast |
| Oxalinastum |
| Oxalinast [INN] |
