Introduction:Basic information about CAS 91935-84-1|3,3,4,4,4-PENTAFLUORO-2-HYDROXY-2-(P-TOLYL)-BUTYRIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3,4,4,4-PENTAFLUORO-2-HYDROXY-2-(P-TOLYL)-BUTYRIC ACID |
|---|
| CAS Number | 91935-84-1 | Molecular Weight | 284.17900 |
|---|
| Density | 1.481g/cm3 | Boiling Point | 371.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9F5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.2ºC |
|---|
Names
| Name | 3,3,4,4,4-pentafluoro-2-hydroxy-2-(2-methylphenyl)butanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.481g/cm3 |
|---|
| Boiling Point | 371.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9F5O3 |
|---|
| Molecular Weight | 284.17900 |
|---|
| Flash Point | 178.2ºC |
|---|
| Exact Mass | 284.04700 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.46480 |
|---|
| Index of Refraction | 1.467 |
|---|
| InChIKey | DFGNEAIEJDJVKM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(O)(C(=O)O)C(F)(F)C(F)(F)F)cc1 |
|---|