Introduction:Basic information about CAS 83006-47-7|p-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(p-tolylamino)sulphonyl]phenyl]azo]-5-oxo-1H-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(p-tolylamino)sulphonyl]phenyl]azo]-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid |
|---|
| CAS Number | 83006-47-7 | Molecular Weight | 541.59900 |
|---|
| Density | 1.47g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C24H23N5O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[3-methyl-4-[[4-methyl-3-[(4-methylphenyl)sulfamoyl]phenyl]diazenyl]-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Molecular Formula | C24H23N5O6S2 |
|---|
| Molecular Weight | 541.59900 |
|---|
| Exact Mass | 541.10900 |
|---|
| PSA | 174.69000 |
|---|
| LogP | 5.96110 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | BQDUPLJLYXLYCF-UHFFFAOYSA-N |
|---|
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1N=Nc1ccc(C)c(S(=O)(=O)Nc2ccc(C)cc2)c1 |
|---|