Introduction:Basic information about CAS 85908-78-7|Chiralyst P291, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chiralyst P291 |
|---|
| CAS Number | 85908-78-7 | Molecular Weight | 291.39400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H22Ru | Melting Point | 85°C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,4-dimethylpenta-1,3-diene,ruthenium(2+) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 85°C |
|---|
| Molecular Formula | C14H22Ru |
|---|
| Molecular Weight | 291.39400 |
|---|
| Exact Mass | 292.07600 |
|---|
| LogP | 4.81140 |
|---|
| Appearance of Characters | solid | yellow |
|---|
| InChIKey | WYILUGVDWAFRSG-UHFFFAOYSA-N |
|---|
| SMILES | [CH-]=C(C)C=C(C)C.[CH-]=C(C)C=C(C)C.[Ru+2] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2901100000 |
|---|
Customs
| HS Code | 2901100000 |
|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Bis(2,4-dimethylpentadienyl)ruthenium(II) |
| bis(dimethylpentadienyl)ruthenium |
| bis(2,4-dimethyl-1,3-pentadienyl)ruthenium(II) |
| bis(2,4-dimethylpentadienyl)ruthenium |