Introduction：Basic information about CAS 90327-03-0|6-Chloronicotinic acid 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloronicotinic acid 1-oxide |
|---|
| CAS Number | 90327-03-0 | Molecular Weight | 173.554 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.0±23.2 °C |
|---|
Names
| Name | 6-chloro-1-oxidopyridin-1-ium-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 489.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4ClNO3 |
|---|
| Molecular Weight | 173.554 |
|---|
| Flash Point | 250.0±23.2 °C |
|---|
| Exact Mass | 172.987976 |
|---|
| PSA | 62.76000 |
|---|
| LogP | -0.77 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | IOBHGRBPVCQMNI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(Cl)[n+]([O-])c1 |
|---|
Synonyms
| 3-Pyridinecarboxylic acid, 6-chloro-, 1-oxide |
| 6-Chloronicotinic acid 1-oxide |
| 6-chloro-1-oxy-nicotinic acid |
| 6-chloronicotinic acid N-oxide |
| 3-Pyridinecarboxylic acid,6-chloro-,1-oxide |
