Introduction：Basic information about CAS 40041-95-0|Angustoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Angustoline |
|---|
| CAS Number | 40041-95-0 | Molecular Weight | 331.36800 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 698.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 376.4ºC |
|---|
Names
| Name | Angustoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 698.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17N3O2 |
|---|
| Molecular Weight | 331.36800 |
|---|
| Flash Point | 376.4ºC |
|---|
| Exact Mass | 331.13200 |
|---|
| PSA | 70.91000 |
|---|
| LogP | 3.15420 |
|---|
| Index of Refraction | 1.771 |
|---|
| InChIKey | NDHJXXLIRWAMEN-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)c1cncc2c(=O)n3c(cc12)-c1[nH]c2ccccc2c1CC3 |
|---|
Synonyms
| 1-(1-hydroxy-ethyl)-8,13-dihydro-7H-indolo[2',3':3,4]pyrido[1,2-b][2,7]naphthyridin-5-one |
| (+-)-Angustolin |
| Indolo(2',3':3,4)pyrido(1,2-b)(2,7)naphthyridin-5(7H)-one,8,13-dihydro-1-(1-hydroxyethyl)-,(-) |
