Introduction：Basic information about CAS 4005-68-9|3-[(4-anilinophenyl)azo]benzenesulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(4-anilinophenyl)azo]benzenesulphonic acid |
|---|
| CAS Number | 4005-68-9 | Molecular Weight | 353.39500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H15N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H15N3O3S |
|---|
| Molecular Weight | 353.39500 |
|---|
| Exact Mass | 353.08300 |
|---|
| PSA | 99.50000 |
|---|
| LogP | 6.24610 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | HLISYGBBLOOIQF-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1cccc(N=Nc2ccc(Nc3ccccc3)cc2)c1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Metanil-Gelb |
| 3-[(4-anilinophenyl)diazenyl]benzenesulfonic acid |
| 3-(4-Anilino-phenylazo)-benzolsulfonsaeure |
| C18H15N3O3S |
| 4-(Phenylamino)-3'-sulfoazobenzene |
| 3-[[4-(phenylamino)phenyl]azo]benzenesulfonic acid |
| Benzenesulfonic acid,m-(p-anilinophenylazo) |
| 4'-Anilino-azobenzol-sulfonsaeure-(3) |
| Mebanil-gelb |
| 3-((4-Anilinophenyl)azo)benzenesulphonic acid |
| 3-(4-anilino-phenylazo)-benzenesulfonic acid |
| (Benzol-sulfonsaeure-(1))-(3 azo 4)-diphenylamin |
| Benzenesulfonic acid,3-((4-(phenylamino)phenyl)azo) |
