Introduction：Basic information about CAS 53878-17-4|furophanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furophanate |
|---|
| CAS Number | 53878-17-4 | Molecular Weight | 303.33600 |
|---|
| Density | 1.3g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H13N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | furophanate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Molecular Formula | C14H13N3O3S |
|---|
| Molecular Weight | 303.33600 |
|---|
| Exact Mass | 303.06800 |
|---|
| PSA | 118.48000 |
|---|
| LogP | 3.50790 |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | TZUAKKVHNFEFBG-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)NC(=S)Nc1ccccc1N=Cc1ccco1 |
|---|
Synonyms
| methyl N-[[2-(furan-2-ylmethylideneamino)phenyl]carbamothioyl]carbamate |
| Carbamic acid,(((2-((2-furanylmethylene)amino)phenyl)amino)thioxomethyl)-,methyl ester |
| Furophanate [ANSI] |
| Furophanate |
| methyl [(2-{[(Ξ)-furan-2-ylmethylidene]amino}phenyl)carbamothioyl]carbamate |
| Methyl (((2-((2-furanylmethylene)amino)phenyl)amino)thioxomethyl)carbamate |
| methyl 4-[(EZ)-2-furfurylideneaminophenyl]-3-thioallophanate |
| methyl N-[[[2-[(2-furanylmethylene)amino]phenyl]amino]thioxomethyl]carbamate |
| Carbamic acid,(((2-((2-furanylmethylene)amino)phenyl)amino)thioxomethyl)-,methyl ester (9CI) |
| Furophanate [ANSI:ISO] |
