Introduction：Basic information about CAS 53950-28-0|N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxy-5-(methylamino)phenyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxy-5-(methylamino)phenyl]acetamide |
|---|
| CAS Number | 53950-28-0 | Molecular Weight | 467.23100 |
|---|
| Density | 1.69g/cm3 | Boiling Point | 701.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrN6O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 378.3ºC |
|---|
Names
| Name | N-[2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-4-methoxy-5-(methylamino)phenyl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.69g/cm3 |
|---|
| Boiling Point | 701.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrN6O6 |
|---|
| Molecular Weight | 467.23100 |
|---|
| Flash Point | 378.3ºC |
|---|
| Exact Mass | 466.02400 |
|---|
| PSA | 170.21000 |
|---|
| LogP | 6.45850 |
|---|
| Index of Refraction | 1.676 |
|---|
| InChIKey | QBILVGKVVDFNJB-UHFFFAOYSA-N |
|---|
| SMILES | CNc1cc(NC(C)=O)c(N=Nc2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
|---|
