Introduction：Basic information about CAS 15114-43-9|dibromoisocyanuricacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dibromoisocyanuricacid |
|---|
| CAS Number | 15114-43-9 | Molecular Weight | 286.866 |
|---|
| Density | 2.8±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C3HBr2N3O3 | Melting Point | 309ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS03, GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 1,3-dibromo-1,3,5-triazinane-2,4,6-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.8±0.1 g/cm3 |
|---|
| Melting Point | 309ºC |
|---|
| Molecular Formula | C3HBr2N3O3 |
|---|
| Molecular Weight | 286.866 |
|---|
| Exact Mass | 284.838440 |
|---|
| PSA | 76.86000 |
|---|
| LogP | -0.33 |
|---|
| Index of Refraction | 1.712 |
|---|
| InChIKey | HHBCEKAWSILOOP-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c(=O)n(Br)c(=O)n1Br |
|---|
| Storage condition | 2~8°C |
|---|
Safety Information
| Symbol |
GHS03, GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H272-H302-H314 |
|---|
| Supplemental HS | Contact with acids liberates toxic gas. |
|---|
| Precautionary Statements | P220-P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | C |
|---|
| RIDADR | UN 3085 5.1/PG 2 |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| MFCD00463941 |
| 1,3-Dibromo-1,3,5-triazinane-2,4,6-trione |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dibromo- |
| dibromoisocyanuricacid |
| dibromisocyanurate |
| dibromoisocyanurate |
| dibromocyanuric acid |
| DibroMoisocyanuric Acid |
| N,N'-dibromoisocyanuric acid |
| 1,3-Dibromo-1,3,5-triazine-2,4,6-trione |
