Introduction:Basic information about CAS 40188-45-2|2-Acetyl-4-butyramidophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Acetyl-4-butyramidophenol |
|---|
| CAS Number | 40188-45-2 | Molecular Weight | 221.25200 |
|---|
| Density | 1.192g/cm3 | Boiling Point | 428ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | 120-126 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 212.6ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Acetyl-4-butyramidophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.192g/cm3 |
|---|
| Boiling Point | 428ºC at 760 mmHg |
|---|
| Melting Point | 120-126 °C(lit.) |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Flash Point | 212.6ºC |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.40640 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | FGWZEOPEZISTTR-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(=O)Nc1ccc(O)c(C(C)=O)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R38 |
|---|
| Safety Phrases | S36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(3-Acetyl-4-hydroxyphenyl)butyramide |
| 2-Acetyl 4-butyramidophenol (N-(3-Acetyl-4-hydroxyphenyl)butanamide |
| 5'-Butyramido-2'-hydroxyacetophenon |
| MFCD00798556 |
| 5-BUTYRAMIDO-2-HYDROXYACETOPHENONE |
| 2-HYDROXY-5-BUTYRAMIDOACETOPHENOL |
| EINECS 254-831-0 |
| 2-Acetyl-4-Butyramidephenol |
| 2-ACETYL-4-BUTYRAMIDO PHENOL |
| 2-Acetyl-4-Butyramidophenol |
| Acebutolol Impurity 3 |