Introduction：Basic information about CAS 874289-37-9|(4-(cyclopropylcarbamoyl)-2-fluorophenyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-(cyclopropylcarbamoyl)-2-fluorophenyl)boronic acid |
|---|
| CAS Number | 874289-37-9 | Molecular Weight | 223.009 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H11BFNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Boronic acid, B-[4-[(cyclopropylamino)carbonyl]-2-fluorophenyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C10H11BFNO3 |
|---|
| Molecular Weight | 223.009 |
|---|
| Exact Mass | 223.081604 |
|---|
| PSA | 69.56000 |
|---|
| LogP | 0.90 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | KUWDYUDHKUBVRQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC1CC1)c1ccc(B(O)O)c(F)c1 |
|---|
Synonyms
| Boronic acid, [4-[(cyclopropylamino)carbonyl]-2-fluorophenyl]- |
| [4-(Cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid |
| Boronic acid, B-[4-[(cyclopropylamino)carbonyl]-2-fluorophenyl]- |
| (4-(cyclopropylcarbamoyl)-2-fluorophenyl)boronic acid |
