Introduction：Basic information about CAS 21436-44-2|m-Toluic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-Toluic anhydride |
|---|
| CAS Number | 21436-44-2 | Molecular Weight | 254.28100 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 414.4ºC at 760mmHg |
|---|
| Molecular Formula | C16H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.7ºC |
|---|
Names
| Name | (3-methylbenzoyl) 3-methylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 414.4ºC at 760mmHg |
|---|
| Molecular Formula | C16H14O3 |
|---|
| Molecular Weight | 254.28100 |
|---|
| Flash Point | 197.7ºC |
|---|
| Exact Mass | 254.09400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.30060 |
|---|
| Vapour Pressure | 4.48E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | DGZSQLHPEZFGSI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C(=O)OC(=O)c2cccc(C)c2)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Methyl-benzoesaeure-anhydrid |
| 3-methyl-benzoic acid-anhydride |
| 3-methylbenzoyl 3-methylbenzoate |
| 3-methylbenzoic anhydride |
| m-Toluic anhydride |
| m-methylbenzoic anhydride |
| 3-methylbenzene-1-carboxylic anhydride |
| m-Toluylsaeure-anhydrid |
