Introduction：Basic information about CAS 86-20-4|9-ethyl-3-nitro-9H-carbazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-ethyl-3-nitro-9H-carbazole |
|---|
| CAS Number | 86-20-4 | Molecular Weight | 240.25700 |
|---|
| Density | 1.27 g/cm3 | Boiling Point | 362.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12N2O2 | Melting Point | 128-130 °C(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9-Ethyl-3-nitrocarbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27 g/cm3 |
|---|
| Boiling Point | 362.3ºC at 760 mmHg |
|---|
| Melting Point | 128-130 °C(lit.) |
|---|
| Molecular Formula | C14H12N2O2 |
|---|
| Molecular Weight | 240.25700 |
|---|
| Exact Mass | 240.09000 |
|---|
| PSA | 50.75000 |
|---|
| LogP | 4.24580 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | WONHLSYSHMRRGO-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c2ccccc2c2cc([N+](=O)[O-])ccc21 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Carbazole,9-ethyl-3-nitro |
| 9-ethyl-3-nitro-carbazole |
| MFCD00022215 |
| 3-Nitro-9-ethylcarbazole |
| 9-Ethyl-3-nitrocarbazol |
| 3-Nitro-N-ethylcarbazole |
| 9H-Carbazole,9-ethyl-3-nitro |
| 9-Ethyl-3-nitro-9H-carbazole |
| ethyl-9 nitro-3 carbazole |
| EINECS 201-655-7 |
| 9-Aethyl-3-nitro-carbazol |
