Introduction:Basic information about CAS 7300-91-6|4-Maleimidophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Maleimidophenol |
|---|
| CAS Number | 7300-91-6 | Molecular Weight | 189.16700 |
|---|
| Density | 1.47 g/cm3 | Boiling Point | 397ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.9°C |
|---|
Names
| Name | 1-(4-hydroxyphenyl)pyrrole-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47 g/cm3 |
|---|
| Boiling Point | 397ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO3 |
|---|
| Molecular Weight | 189.16700 |
|---|
| Flash Point | 193.9°C |
|---|
| Exact Mass | 189.04300 |
|---|
| PSA | 57.61000 |
|---|
| LogP | 0.88660 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | BLLFPKZTBLMEFG-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=CC(=O)N1c1ccc(O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-hydroxyphenylmaleimide |
| 1-(4-Hydroxyphenyl)-1H-pyrrole-2,5-dione |
| 1-(4-hydroxy-phenyl)-pyrrole-2,5-dione |
| 4-maleimidophenol |
| 1-(4-Hydroxyphenyl)-2,5-dioxo-pyrrole |
| N-(4-hydroxyphenyl)maleimide |
| 1-(4-hydroxyphenyl)maleimide |
| N-(p-hydroxyphenyl)-maleimide |