Introduction：Basic information about CAS 6890-77-3|2-(3-nitrophenyl)-2-oxo-acetaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-nitrophenyl)-2-oxo-acetaldehyde |
|---|
| CAS Number | 6890-77-3 | Molecular Weight | 179.13000 |
|---|
| Density | 1.376g/cm3 | Boiling Point | 300ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.1ºC |
|---|
Names
| Name | 2-(3-nitrophenyl)-2-oxoacetaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.376g/cm3 |
|---|
| Boiling Point | 300ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5NO4 |
|---|
| Molecular Weight | 179.13000 |
|---|
| Flash Point | 147.1ºC |
|---|
| Exact Mass | 179.02200 |
|---|
| PSA | 79.96000 |
|---|
| LogP | 1.49960 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | PPDGMLLCCLUIKZ-UHFFFAOYSA-N |
|---|
| SMILES | O=CC(=O)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2914400090 |
|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| (3-Nitro-phenyl)-oxo-acetaldehyde |
| 2-(3-nitrophenyl)-2-oxo-acetaldehyde |
| m-nitrophenylglyoxal |
| m-nitrophenylglyoxal monhydrate |
| 3-Nitro-benzoylformaldehyd |
| (3-Nitro-phenyl)-glyoxal |
| 2-oxo-2-(3-nitrophenyl)acetaldehyde |
