Introduction：Basic information about CAS 90162-60-0|Isbufylline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Isbufylline |
|---|
| CAS Number | 90162-60-0 | Molecular Weight | 236.27000 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 425ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.8ºC |
|---|
Names
| Name | 1,3-dimethyl-7-(2-methylpropyl)purine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 425ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N4O2 |
|---|
| Molecular Weight | 236.27000 |
|---|
| Flash Point | 210.8ºC |
|---|
| Exact Mass | 236.12700 |
|---|
| PSA | 61.82000 |
|---|
| LogP | 0.08970 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | WHUWQSQEVISUMC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
|---|
Synonyms
| Isbufylline [INN] |
| TE-06 |
| Isbufilina [INN-Spanish] |
| 7-isobutyl-1,3-dimethylxanthine |
| Isbufyllinum [INN-Latin] |
| Theophylline,7-isobutyl |
| Isbufylline |
| 7-Isobutyltheophylline |
| 1,3-Dimethyl-7-isobutyl-xanthine |
