Introduction：Basic information about CAS 75482-18-7|Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate |
|---|
| CAS Number | 75482-18-7 | Molecular Weight | 516.50200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H19F6PS2 | Melting Point | 126 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 126 °C |
|---|
| Molecular Formula | C24H19F6PS2 |
|---|
| Molecular Weight | 516.50200 |
|---|
| Exact Mass | 516.05700 |
|---|
| PSA | 64.19000 |
|---|
| LogP | 10.31560 |
|---|
| InChIKey | SFWSATMGMAKCIF-UHFFFAOYSA-N |
|---|
| SMILES | F[P-](F)(F)(F)(F)F.c1ccc(Sc2ccccc2[S+](c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| sulfonium diphenyl[(phenylthio)phenyl] hexafluorophosphate |
| Sulphonium diphenyl[(phenylthio)phenyl]hexafluorophosphate |
| Mixed of Triaryl-sulfonium Hexafluoro-Phosphate Salt |
