Introduction：Basic information about CAS 519056-51-0|4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|
| CAS Number | 519056-51-0 | Molecular Weight | 269.22300 |
|---|
| Density | 1.339g/cm3 | Boiling Point | 429.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10F3N3O | Melting Point | 191ºC |
|---|
| MSDS | / | Flash Point | 213.6ºC |
|---|
Names
| Name | 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.339g/cm3 |
|---|
| Boiling Point | 429.5ºC at 760 mmHg |
|---|
| Melting Point | 191ºC |
|---|
| Molecular Formula | C12H10F3N3O |
|---|
| Molecular Weight | 269.22300 |
|---|
| Flash Point | 213.6ºC |
|---|
| Exact Mass | 269.07800 |
|---|
| PSA | 61.03000 |
|---|
| LogP | 3.33440 |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | RAYWTBJRRQFSID-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(N)n2)cc1 |
|---|
Synonyms
| 4-trifluoromethyl-6-(4-methoxyphenyl)-2-aminopyrimidine |
| 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine-2-ylamine |
