Introduction：Basic information about CAS 305808-19-9|N6--Benzoyl-2'-deoxyadenosine hydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N6--Benzoyl-2'-deoxyadenosine hydrate |
|---|
| CAS Number | 305808-19-9 | Molecular Weight | 355.34800 |
|---|
| Density | 1.61g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H17N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113 °C |
|---|
Names
| Name | N6-Benzoyl-2'-deoxyadenosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Molecular Formula | C17H17N5O4 |
|---|
| Molecular Weight | 355.34800 |
|---|
| Flash Point | 113 °C |
|---|
| Exact Mass | 355.12800 |
|---|
| PSA | 122.39000 |
|---|
| LogP | 0.79230 |
|---|
| Index of Refraction | 1.762 |
|---|
| InChIKey | PIXHJAPVPCVZSV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ncnc2c1ncn2C1CC(O)C(CO)O1)c1ccccc1 |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| N6--Benzoyl-2'-deoxyadenosine hydrate |
| N6-BZ-2'-DEOXYADENOSINE |
| DA-BZ |
| MFCD00009628 |
| N-(9-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide |
| N-BZ-DA |
| Bz-dA |
| dA(bz) CPG derivatized 500Angs |
| REF DUPL: dA(bz) CPG derivatized 500Angs |
| N6-Bz-dA |
| N6-BENZOYLDEOXYADENOSINE |
| EINECS 224-903-6 |
