Introduction:Basic information about CAS 158861-67-7|Pralmorelin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pralmorelin |
|---|
| CAS Number | 158861-67-7 | Molecular Weight | 746.89700 |
|---|
| Density | 1.27 g/cm3 | Boiling Point | 1265.3ºC at 760 mmHg |
|---|
| Molecular Formula | C42H50N8O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 719ºC |
|---|
Names
| Name | Pralmorelin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27 g/cm3 |
|---|
| Boiling Point | 1265.3ºC at 760 mmHg |
|---|
| Molecular Formula | C42H50N8O5 |
|---|
| Molecular Weight | 746.89700 |
|---|
| Flash Point | 719ºC |
|---|
| Exact Mass | 746.39000 |
|---|
| PSA | 227.32000 |
|---|
| LogP | 5.91420 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | HRNLPPBUBKMZMT-RDRUQFPZSA-N |
|---|
| SMILES | CC(N)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(N)=O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
Synonyms
| GHRP-2 ACETATE |
| GHRP-2 |
| (2S,5R,8S,11S,14R,17R)-17-amino-2-(4-aminobutyl)-5-benzyl-8-(1H-indol-3-ylmethyl)-11-methyl-14-(naphthalen-2-ylmethyl)-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentaazaoctadecan-1-amide (non-preferred name) |
| Growth hormone-releasing peptide 2 |
| 4-dichloro-1 |
| D-Alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide |
| Pralmorelin |
| 4]triazolo[4 |
| GHRP 2 |
| MFCD05663458 |
| 6-dihydro-[1 |
| L-Lysinamide, D-alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl- |
| CHRP-2 |
| D-alanyl-3-(2-naphthyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinaamide dihydrochloride |
| GHCA |
| D-Alanyl-3-(2-naphthyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide |
| Tributyl(2-(2 |