Introduction：Basic information about CAS 38464-20-9|4-chloro-3-nitro-chromen-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-3-nitro-chromen-2-one |
|---|
| CAS Number | 38464-20-9 | Molecular Weight | 225.585 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 338.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H4ClNO4 | Melting Point | 160-164 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 158.6±27.9 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Chloro-3-nitrocoumarin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 338.7±42.0 °C at 760 mmHg |
|---|
| Melting Point | 160-164 °C(lit.) |
|---|
| Molecular Formula | C9H4ClNO4 |
|---|
| Molecular Weight | 225.585 |
|---|
| Flash Point | 158.6±27.9 °C |
|---|
| Exact Mass | 224.982880 |
|---|
| PSA | 76.03000 |
|---|
| LogP | 1.54 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | OFLRQEKOAGDHKT-UHFFFAOYSA-N |
|---|
| SMILES | O=c1oc2ccccc2c(Cl)c1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 4-chloro-3-nitrochromen-2-one |
| 2H-1-Benzopyran-2-one, 4-chloro-3-nitro- |
| MFCD00051670 |
| 4-chloro-3-nitro-chromen-2-one |
| 4-Chloro-3-nitro-2H-chromen-2-one |
| 4-Chloro-3-nitrocouMarin |
