Introduction：Basic information about CAS 57835-99-1|TriphenylsulfoniumHexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | TriphenylsulfoniumHexafluorophosphate |
|---|
| CAS Number | 57835-99-1 | Molecular Weight | 408.34100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H15F6PS | Melting Point | 206 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | triphenyl sulfonium hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 206 °C |
|---|
| Molecular Formula | C18H15F6PS |
|---|
| Molecular Weight | 408.34100 |
|---|
| Exact Mass | 408.05400 |
|---|
| PSA | 38.89000 |
|---|
| LogP | 8.16440 |
|---|
| InChIKey | OFOZWFGJJSDVIP-UHFFFAOYSA-N |
|---|
| SMILES | F[P-](F)(F)(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| triphenylsulphonium hexafluorophosphate |
| Triphenylsulfoniumhexfluorophosphate |
| triphenyl-sulfoniu hexafluorophosphate |
| triphenylsulfonium salt of hexafluorophosphate |
| Sulfonium,triphenyl-,hexafluorophosphate |
