Introduction：Basic information about CAS 67888-96-4|2,2',4,5,5'-Pentabromobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',4,5,5'-Pentabromobiphenyl |
|---|
| CAS Number | 67888-96-4 | Molecular Weight | 548.68800 |
|---|
| Density | 2.328 g/cm3 | Boiling Point | 436.7ºC |
|---|
| Molecular Formula | C12H5Br5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.5ºC |
|---|
Names
| Name | 2,2',4,5,5'-Pentabromobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.328 g/cm3 |
|---|
| Boiling Point | 436.7ºC |
|---|
| Molecular Formula | C12H5Br5 |
|---|
| Molecular Weight | 548.68800 |
|---|
| Flash Point | 210.5ºC |
|---|
| Exact Mass | 543.63100 |
|---|
| LogP | 7.16610 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | OELBLPCWLAWABI-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc(Br)c(-c2cc(Br)c(Br)cc2Br)c1 |
|---|
Synonyms
| 1,2,4-tribromo-5-(2,5-dibromophenyl)benzene |
