Introduction：Basic information about CAS 59080-39-6|2,2',4,5',6-Pentabromobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',4,5',6-Pentabromobiphenyl |
|---|
| CAS Number | 59080-39-6 | Molecular Weight | 548.688 |
|---|
| Density | 2.3±0.1 g/cm3 | Boiling Point | 428.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H5Br5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.8±22.1 °C |
|---|
Names
| Name | 2,2',4,5',6-Pentabromobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.3±0.1 g/cm3 |
|---|
| Boiling Point | 428.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H5Br5 |
|---|
| Molecular Weight | 548.688 |
|---|
| Flash Point | 205.8±22.1 °C |
|---|
| Exact Mass | 543.630798 |
|---|
| LogP | 7.15 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | NVKQKAZYUPPRJX-UHFFFAOYSA-N |
|---|
| SMILES | Brc1cc(Br)c(-c2cc(Br)ccc2Br)c(Br)c1 |
|---|
Synonyms
| 1,1'-Biphenyl, 2,2',4,5',6-pentabromo- |
| Biphenyl, 2,2',4,5',6-pentabromo- |
| 1,3,5-tribromo-2-(2,5-dibromophenyl)benzene |
| 2,2',4,5',6-Pentabromobiphenyl |
| 2,2',4,5',6-Pentabromo-1,1'-biphenyl |
