Introduction：Basic information about CAS 848357-29-9|1H-Indole-1-carboxylic acid, 5-acetyl-2-borono-, 1-(1,1-dimethylethyl) ester (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-1-carboxylic acid, 5-acetyl-2-borono-, 1-(1,1-dimethylethyl) ester (9CI) |
|---|
| CAS Number | 848357-29-9 | Molecular Weight | 303.11800 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 502.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18BNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 257.5ºC |
|---|
Names
| Name | 1H-Indole-1-carboxylic acid, 5-acetyl-2-borono-, 1-(1,1-dimethylethyl) ester (9CI) |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 502.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18BNO5 |
|---|
| Molecular Weight | 303.11800 |
|---|
| Flash Point | 257.5ºC |
|---|
| Exact Mass | 303.12800 |
|---|
| PSA | 88.76000 |
|---|
| LogP | 1.30690 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | JNZXANWFJBJUNO-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc2c(c1)cc(B(O)O)n2C(=O)OC(C)(C)C |
|---|
