Introduction：Basic information about CAS 900802-72-4|Cyclopropanamine, 1-[3-(1,1-dimethylethyl)phenyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclopropanamine, 1-[3-(1,1-dimethylethyl)phenyl] |
|---|
| CAS Number | 900802-72-4 | Molecular Weight | 189.29700 |
|---|
| Density | 0.995g/cm3 | Boiling Point | 251.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 102.1ºC |
|---|
Names
| Name | Cyclopropanamine, 1-[3-(1,1-dimethylethyl)phenyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.995g/cm3 |
|---|
| Boiling Point | 251.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N |
|---|
| Molecular Weight | 189.29700 |
|---|
| Flash Point | 102.1ºC |
|---|
| Exact Mass | 189.15200 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 3.63220 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | CEPJQAFVPMIAJG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cccc(C2(N)CC2)c1 |
|---|
Synonyms
| Urea,N'-[3-(1,1-dimethylethyl)phenyl]-N-methoxy-N-methyl |
| 1-(3-tert-butylphenyl)-3-methyl-3-methoxyurea |
| 1-(3-tert-butyl-phenyl)-cyclopropylamine |
| N-methyl-N-methoxy-N'-(3-tert-butyl-phenyl)-urea |
