Introduction：Basic information about CAS 900505-08-0|Cyclopropanamine, 1-(4-chloro-3-nitrophenyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclopropanamine, 1-(4-chloro-3-nitrophenyl) |
|---|
| CAS Number | 900505-08-0 | Molecular Weight | 212.63300 |
|---|
| Density | 1.444g/cm3 | Boiling Point | 324.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.3ºC |
|---|
Names
| Name | Cyclopropanamine, 1-(4-chloro-3-nitrophenyl) |
|---|
Chemical & Physical Properties
| Density | 1.444g/cm3 |
|---|
| Boiling Point | 324.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9ClN2O2 |
|---|
| Molecular Weight | 212.63300 |
|---|
| Flash Point | 150.3ºC |
|---|
| Exact Mass | 212.03500 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.41950 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | GKDYGZDTYBFEGW-UHFFFAOYSA-N |
|---|
| SMILES | NC1(c2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
|---|
